CAS 74396-74-0
:7-chloro-3-(hydroxyamino)-2H-indol-2-one
Description:
7-Chloro-3-(hydroxyamino)-2H-indol-2-one, with the CAS number 74396-74-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a chlorine atom at the 7-position and a hydroxyamino group at the 3-position, contributing to its unique reactivity and potential biological activity. The presence of the hydroxyamino group suggests that it may participate in various chemical reactions, including those involving nucleophilic substitution or redox processes. The chlorine substituent can influence the compound's solubility and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological macromolecules. Additionally, its stability and reactivity under different conditions can be influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11-13/h1-3,13H,(H,10,11,12)
SMILES:c1cc2c(c(c1)Cl)NC(=O)C2=NO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.