CymitQuimica logo

CAS 74396-78-4

:

3-(hydroxyamino)-7-(trifluoromethyl)-2H-indol-2-one

Description:
3-(Hydroxyamino)-7-(trifluoromethyl)-2H-indol-2-one, with the CAS number 74396-78-4, is a chemical compound that belongs to the indole family, characterized by its indole core structure which is a bicyclic compound containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This specific compound features a hydroxyamino group and a trifluoromethyl group, which significantly influence its chemical reactivity and properties. The hydroxyamino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents, while the trifluoromethyl group is known for imparting unique electronic properties and increasing lipophilicity. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as they may contribute to biological activity. Additionally, the compound's structure may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Overall, this compound exemplifies the complexity and diversity of indole derivatives in chemical research.
Formula:C9H5F3N2O2
InChI:InChI=1/C9H5F3N2O2/c10-9(11,12)5-3-1-2-4-6(5)13-8(15)7(4)14-16/h1-3,16H,(H,13,14,15)
SMILES:c1cc2c(c(c1)C(F)(F)F)NC(=O)C2=NO
Synonyms:
  • (3Z)-7-(trifluoromethyl)-1H-indole-2,3-dione 3-oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.