CAS 744-05-8
:methyl 4-O-hexopyranosylhexopyranoside
Description:
Methyl 4-O-hexopyranosylhexopyranoside, with the CAS number 744-05-8, is a glycoside compound characterized by its structure, which consists of a methyl group attached to a hexopyranosyl moiety linked to another hexopyranosyl unit. This compound is typically derived from sugars and exhibits properties common to glycosides, such as solubility in water and potential sweetness, depending on the specific hexose sugars involved. It may participate in various chemical reactions, including hydrolysis, where it can release sugars upon treatment with acids or enzymes. Methyl 4-O-hexopyranosylhexopyranoside is of interest in biochemical research and applications, particularly in the study of carbohydrate chemistry and its implications in biological systems. Its structural features may influence its reactivity, stability, and interactions with other biomolecules, making it a subject of interest in fields such as medicinal chemistry and food science.
Formula:C13H24O11
InChI:InChI=1/C13H24O11/c1-21-12-10(20)8(18)11(5(3-15)23-12)24-13-9(19)7(17)6(16)4(2-14)22-13/h4-20H,2-3H2,1H3
SMILES:COC1C(C(C(C(CO)O1)OC1C(C(C(C(CO)O1)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl β-D-maltopyranoside
CAS:<p>Methyl β-D-maltopyranoside</p>Purity:>95%Color and Shape:White SolidMolecular weight:356.32g/molMethyl β-D-maltopyranoside
CAS:<p>Methyl β-D-maltopyranoside is a disaccharide that is an aglycon of maltosides. It has been shown to bind to the active site of alpha-d-glucopyranosidases, which are enzymes that hydrolyze alpha-d-glucopyranosides. Methyl β-D-maltopyranoside has also been shown to interact with dihedral angles and hydroxyl groups in the enzyme binding region, which may be due to conformational changes in the enzyme's active site. The kinetic constants for methyl β-D-maltopyranoside have been calculated by using an algorithm.</p>Formula:C13H24O11Purity:(%) Min. 98%Color and Shape:PowderMolecular weight:356.32 g/mol
