CAS 74401-71-1
:N,N-diacetyl-L-cysteine
Description:
N,N-Diacetyl-L-cysteine (DAC) is a derivative of the amino acid L-cysteine, characterized by the presence of two acetyl groups attached to the nitrogen atom of the cysteine's amino group. This modification enhances its stability and solubility compared to L-cysteine. DAC is typically a white to off-white crystalline powder, and it is soluble in water and various organic solvents, making it versatile for different applications. The compound is known for its antioxidant properties and is often studied for its potential therapeutic effects, particularly in respiratory conditions and as a mucolytic agent. Additionally, DAC may play a role in the synthesis of other bioactive compounds and is utilized in research related to cellular signaling and redox biology. Its safety profile is generally favorable, but like any chemical, it should be handled with care in laboratory settings. Overall, N,N-diacetyl-L-cysteine is a valuable compound in both pharmaceutical and biochemical research contexts.
Formula:C7H11NO4S
InChI:InChI=1/C7H11NO4S/c1-4(9)8(5(2)10)6(3-13)7(11)12/h6,13H,3H2,1-2H3,(H,11,12)/t6-/m0/s1
Synonyms:- L-Cysteine, N,N-diacetyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-C-77104
Discontinued product
