CAS 74404-34-5

(2-Ethyl-6-methylphenyl)hydrazine

Description:

(2-Ethyl-6-methylphenyl)hydrazine, with the CAS number 74404-34-5, is an organic compound characterized by its hydrazine functional group attached to a substituted phenyl ring. This compound features an ethyl group at the 2-position and a methyl group at the 6-position of the phenyl ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the hydrazine group imparts notable reactivity, particularly in redox reactions and as a potential ligand in coordination chemistry. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. However, due to the presence of the hydrazine moiety, it may also pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its applications may extend to various fields, including organic synthesis and materials science, although specific uses can vary based on ongoing research and development.

Formula: C₉H₁₄N₂

InChI: InChI=1S/C9H14N2/c1-3-8-6-4-5-7(2)9(8)11-10/h4-6,11H,3,10H2,1-2H3

InChI key: InChIKey=RNOZNCRHRYXBTD-UHFFFAOYSA-N

SMILES: C(C)C1=C(NN)C(C)=CC=C1

Synonyms:

• (2-Ethyl-6-methylphenyl)hydrazine
• 2-Ethyl-6-methylphenylhydrazine
• Hydrazine, (2-ethyl-6-methylphenyl)-