![Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-(hydrogen butanedioate)](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F565623-cytidine-n-benzoyl-5-o-bis-4-methoxyphenyl-phenylmethyl-2-deoxy-3-hydrogen-butanedioate.webp&w=3840&q=75)
CAS 74405-44-0
:Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-(hydrogen butanedioate)
Description:
Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-(hydrogen butanedioate), with CAS number 74405-44-0, is a complex nucleoside derivative characterized by its structural modifications that enhance its biochemical properties. This compound features a cytidine base, which is a nucleoside composed of a pyrimidine base (cytosine) linked to a ribose sugar, but in this case, it is a deoxyribonucleoside, indicating the absence of an oxygen atom at the 2' position of the sugar. The presence of a benzoyl group and a bis(4-methoxyphenyl)phenylmethyl moiety suggests that it has significant hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The 3′-hydrogen butanedioate group indicates the presence of a carboxylic acid derivative, which could play a role in the compound's reactivity and potential biological activity. Overall, this compound may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and biochemistry research.
Formula:C41H39N3O10
InChI:InChI=1S/C41H39N3O10/c1-50-31-17-13-29(14-18-31)41(28-11-7-4-8-12-28,30-15-19-32(51-2)20-16-30)52-26-34-33(54-38(47)22-21-37(45)46)25-36(53-34)44-24-23-35(43-40(44)49)42-39(48)27-9-5-3-6-10-27/h3-20,23-24,33-34,36H,21-22,25-26H2,1-2H3,(H,45,46)(H,42,43,48,49)/t33-,34+,36+/m0/s1
InChI key:InChIKey=GJWDGMQWTLYOCO-GABYNLOESA-N
SMILES:C(OC[C@@H]1[C@@H](OC(CCC(O)=O)=O)C[C@@H](O1)N2C(=O)N=C(NC(=O)C3=CC=CC=C3)C=C2)(C4=CC=C(OC)C=C4)(C5=CC=C(OC)C=C5)C6=CC=CC=C6
Synonyms:- Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-(hydrogen butanedioate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N4-Benzoyl-2'-deoxy-5'-O-DMT-cytidine 3'-O-succinate triethylamine salt
CAS:<p>N4-Benzoyl-2'-deoxy-5'-O-DMT-cytidine 3'-O-succinate triethylamine salt is a synthetic antiviral agent that can be used in the treatment of HIV. This drug inhibits the viral DNA polymerase and prevents virus replication. N4-Benzoyl-2'-deoxy-5'-O-DMT cytidine 3'-O succinate triethylamine salt is a novel nucleoside analogue with a monophosphate group at the 5' position and an N4 benzoyl group at the 2' position. It is an activator of DNA synthesis, which can be used for cancer chemotherapy. The chemical name for this drug is CAS No. 74405-44-0 (free base).</p>Formula:C41H39N3O10·C6H15NPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:834.95 g/mol
