CAS 74407-70-8
:Propanoic acid, 3-(benzoylthio)-2-methyl-, (R)-
Description:
Propanoic acid, 3-(benzoylthio)-2-methyl-, (R)-, with the CAS number 74407-70-8, is an organic compound characterized by its carboxylic acid functional group, which imparts acidic properties. This compound features a propanoic acid backbone with a benzoylthio group and a methyl substituent at specific positions, contributing to its unique chemical behavior and potential reactivity. The presence of the benzoylthio moiety suggests that it may exhibit properties associated with thioesters or thioethers, potentially influencing its solubility and reactivity in various chemical environments. As an enantiomer, the (R)- designation indicates a specific spatial arrangement of its atoms, which can affect its biological activity and interactions. Generally, compounds like this may be utilized in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. However, specific applications and properties would depend on further empirical studies and context within chemical research.
Formula:C11H12O3S
InChI:InChI=1/C11H12O3S/c1-8(10(12)13)7-15-11(14)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)/t8-/m0/s1
InChI key:InChIKey=BCAYPPFBOJCRPN-QMMMGPOBSA-N
SMILES:C(SC[C@@H](C(O)=O)C)(=O)C1=CC=CC=C1
Synonyms:- Propanoic acid, 3-(benzoylthio)-2-methyl-, (R)-
- (R)-3-(Benzoylthio)-2-methylpropionic acid
- (2R)-2-methyl-3-[(phenylcarbonyl)sulfanyl]propanoic acid
- (R)-(+)-3-(Benzoylthio)-2-methylpropionic acid
- (2R)-3-(Benzoylsulfanyl)-2-methylpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

