CAS 74410-74-5

Symlandine

Description:

Symlandine, identified by the CAS number 74410-74-5, is a chemical compound that falls under the category of synthetic organic substances. While specific details about its characteristics may not be widely documented, compounds like Symlandine typically exhibit properties such as solubility in organic solvents, stability under standard conditions, and potential reactivity with various functional groups. The molecular structure of such compounds often influences their physical properties, including melting and boiling points, density, and viscosity. Additionally, Symlandine may have applications in various fields, including pharmaceuticals, agriculture, or materials science, depending on its functional groups and reactivity. Safety data sheets and regulatory information would provide insights into its toxicity, handling precautions, and environmental impact. For precise applications and characteristics, consulting specialized literature or databases would be essential, as the information available may vary based on the context of use and research focus.

Formula: C₂₀H₃₁NO₆

InChI: InChI=1S/C20H31NO6/c1-6-13(4)18(23)27-16-8-10-21-9-7-15(17(16)21)11-26-19(24)20(25,12(2)3)14(5)22/h6-7,12,14,16-17,22,25H,8-11H2,1-5H3/b13-6-/t14-,16+,17+,20-/m0/s1

InChI key: InChIKey=MVWPTZQHBOWRTF-QKJMJVMDSA-N

SMILES: C(OC([C@]([C@H](C)C)([C@H](C)O)O)=O)C=1[C@]2(N(CC[C@H]2OC(/C(=C\C)/C)=O)CC1)[H]

Synonyms:

• 2-Butenoic acid, 2-methyl-, 7-[[2,3-dihydroxy-2-(1-methylethyl)-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, [1R-[1α(Z),7(2S*,3S*),7aβ]]-
• 2-Butenoic acid, 2-methyl-, (1R,7aR)-7-[[(2S,3S)-2,3-dihydroxy-2-(1-methylethyl)-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, (2Z)-
• Symlandine
• 7-Angelyl-9-viridiflorylretronecine

Symlandine

CAS: 74410-74-5

Symlandine is a novel biochemical compound, which is a synthetic derivative of naturally occurring alkaloids with extensive therapeutic potential. It functions primarily by interacting with cellular signaling pathways, specifically targeting enzymatic receptors to modulate cellular communications and metabolic responses.

Formula: C₂₀H₃₁NO₆

Purity: Min. 95%

Molecular weight: 381.5 g/mol

Ref: 3D-ZCA41074