CymitQuimica logo

CAS 74411-22-6

:

4-hydrazinylphenyl thiocyanate

Description:
4-Hydrazinylphenyl thiocyanate, with the CAS number 74411-22-6, is an organic compound characterized by the presence of a hydrazine functional group and a thiocyanate group attached to a phenyl ring. This compound typically appears as a solid and may exhibit a range of physical properties, including solubility in polar solvents due to the presence of the hydrazine moiety. It is known for its potential applications in various fields, including medicinal chemistry and materials science, owing to its reactivity and ability to form coordination complexes. The hydrazine group can participate in various chemical reactions, such as oxidation and condensation, while the thiocyanate group can act as a ligand in coordination chemistry. Safety considerations are important when handling this compound, as hydrazines are generally considered to be toxic and potentially carcinogenic. Proper laboratory practices should be followed to mitigate exposure risks. Overall, 4-hydrazinylphenyl thiocyanate is a compound of interest for its chemical reactivity and potential applications in research and industry.
Formula:C7H7N3S
InChI:InChI=1/C7H7N3S/c8-5-11-7-3-1-6(10-9)2-4-7/h1-4,10H,9H2
SMILES:c1cc(ccc1NN)SC#N
Synonyms:
  • 4-Hydrazinophenyl Thiocyanate
  • Thiocyanic Acid, 4-Hydrazinylphenyl Ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.