CAS 74418-15-8
:1-[3-(trifluoromethyl)phenyl]-1,4-diazepane
Description:
1-[3-(Trifluoromethyl)phenyl]-1,4-diazepane is a chemical compound characterized by its unique structure, which includes a diazepane ring—a seven-membered heterocyclic structure containing two nitrogen atoms. The presence of a trifluoromethyl group attached to a phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group contributes to its stability and can also impact its reactivity, making it of interest in various fields, including medicinal chemistry and materials science. The compound's CAS number, 74418-15-8, allows for easy identification and reference in chemical databases. Due to its structural features, it may interact with biological systems, making it a candidate for further research in pharmacology or as a building block in synthetic chemistry. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles.
Formula:C12H15F3N2
InChI:InChI=1/C12H15F3N2/c13-12(14,15)10-3-1-4-11(9-10)17-7-2-5-16-6-8-17/h1,3-4,9,16H,2,5-8H2
SMILES:c1cc(cc(c1)N1CCCNCC1)C(F)(F)F
Synonyms:- 1-(3-Trifluoromethylphenyl)-[1,4]diazepane
- 74418-15-8
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[3-(Trifluoromethyl)phenyl]-1,4-diazepane
CAS:1-[3-(Trifluoromethyl)phenyl]-1,4-diazepane
Molecular weight:244.25611g/mol

