CAS 744193-07-5
:1,5-dimethyl-1H-pyrrole-2-carboximidamide
Description:
1,5-Dimethyl-1H-pyrrole-2-carboximidamide is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features two methyl groups attached to the first carbon of the pyrrole ring and a carboximidamide functional group at the second position. The presence of the carboximidamide group imparts unique reactivity and potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide functional group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C7H11N3
InChI:InChI=1/C7H11N3/c1-5-3-4-6(7(8)9)10(5)2/h3-4H,1-2H3,(H3,8,9)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,5-Dimethyl-1H-pyrrole-2-carboximidamide hydrochloride
CAS:Formula:C7H12ClN3Molecular weight:173.6433
