CAS 744197-44-2

2-[amino(p-tolyl)methyl]naphthalen-1-ol

Description:

2-[Amino(p-tolyl)methyl]naphthalen-1-ol, with the CAS number 744197-44-2, is an organic compound characterized by its complex structure that includes a naphthalene ring, an amino group, and a hydroxyl group. This compound features a p-tolyl group, which is a para-substituted toluene moiety, attached to the amino group, contributing to its hydrophobic characteristics. The presence of the hydroxyl group enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The amino group can act as a base, allowing for potential protonation under acidic conditions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and materials science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₈H₁₇NO

InChI: InChI=1/C18H17NO/c1-12-6-8-14(9-7-12)17(19)16-11-10-13-4-2-3-5-15(13)18(16)20/h2-11,17,20H,19H2,1H3

Synonyms:

• 2-[Amino(4-methylphenyl)methyl]-1-naphthol
• 1-naphthalenol, 2-[amino(4-methylphenyl)methyl]-

2-(Amino-p-tolyl-methyl)-naphthalen-1-ol

CAS: 744197-44-2

2-(Amino-p-tolyl-methyl)-naphthalen-1-ol

Purity: 95%

Molecular weight: 263.33g/mol

Ref: 54-OR1075348