CymitQuimica logo

CAS 74420-02-3

:

1H-Pyrrolo[2,3-b]pyridin-4-ol

Description:
1H-Pyrrolo[2,3-b]pyridin-4-ol, with the CAS number 74420-02-3, is a heterocyclic organic compound characterized by a fused ring system that includes both pyrrole and pyridine structures. This compound typically exhibits a planar configuration due to its aromatic nature, which contributes to its stability and potential reactivity. It is known for its ability to participate in various chemical reactions, making it of interest in medicinal chemistry and organic synthesis. The presence of the hydroxyl group (-OH) at the 4-position enhances its solubility in polar solvents and may influence its biological activity. Additionally, the compound may exhibit properties such as fluorescence or photochemical reactivity, depending on its environment. Its unique structure allows for potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacological properties and toxicity are essential for understanding its full potential and safety profile in various applications.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10)
InChI key:InChIKey=IXIGMDXJXKDZOF-UHFFFAOYSA-N
SMILES:OC1=C2C(=NC=C1)NC=C2
Synonyms:
  • 1,7-Dideazahypoxanthine
  • 1,7-Dihydropyrrolo[2,3-b]pyridin-4-one
  • 4-Hydroxy-7-Azaindole
  • 1H-Pyrrolo[2,3-b]pyridin-4-ol
Found 4 products.