CAS 74420-03-4

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-, 7-oxide

Description:

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-, 7-oxide, identified by the CAS number 74420-03-4, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes both pyrrole and pyridine rings. This compound features a chlorine atom at the 4-position and an oxide group at the 7-position, which contribute to its chemical reactivity and potential biological activity. The presence of the chlorine atom can influence the compound's lipophilicity and interaction with biological targets, while the oxide group may affect its electron density and stability. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, it may also exhibit unique spectroscopic properties, making it suitable for various analytical techniques. Overall, 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-, 7-oxide represents a class of compounds with diverse applications in research and industry.

Formula: C₇H₅ClN₂O

InChI: InChI=1S/C7H5ClN2O/c8-6-2-4-10(11)7-5(6)1-3-9-7/h1-4,9H

InChI key: InChIKey=BBEVKNOADIMMDC-UHFFFAOYSA-N

SMILES: ClC1=C2C(=N(=O)C=C1)NC=C2

Synonyms:

• 4-Chloro-1H-pyrrolo[2,3-b]pyridine 7-oxide
• 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-, 7-oxide

4-Chloro-1H-pyrrolo[2,3-b]pyridine 7-oxide

CAS: 74420-03-4

Formula: C₇H₅ClN₂O

Molecular weight: 168.5804

Ref: IN-DA005BNV