
CAS 744219-31-6
:1,1-Dimethylethyl 4-(1H-indazol-4-yl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-(1H-indazol-4-yl)-1-piperazinecarboxylate, identified by its CAS number 744219-31-6, is a chemical compound that features a complex structure incorporating both a piperazine and an indazole moiety. This compound typically exhibits characteristics such as being a solid at room temperature, with potential solubility in organic solvents. Its molecular structure suggests it may possess biological activity, potentially acting as a pharmacophore in medicinal chemistry. The presence of the piperazine ring often indicates potential interactions with neurotransmitter receptors, while the indazole component may contribute to its pharmacological properties. The compound's synthesis may involve standard organic reactions, including coupling reactions and esterification. As with many organic compounds, it is essential to handle it with care, observing appropriate safety protocols due to potential toxicity or reactivity. Overall, this compound may be of interest in research fields such as drug development and materials science, although specific applications would depend on further studies and characterization.
Formula:C16H22N4O2
InChI:InChI=1S/C16H22N4O2/c1-16(2,3)22-15(21)20-9-7-19(8-10-20)14-6-4-5-13-12(14)11-17-18-13/h4-6,11H,7-10H2,1-3H3,(H,17,18)
InChI key:InChIKey=IVXDTYMAMQEGKV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCN(C2=C3C(=CC=C2)NN=C3)CC1
Synonyms:- 1,1-Dimethylethyl 4-(1H-indazol-4-yl)-1-piperazinecarboxylate
- 4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]-1H-indazole
- 1-Piperazinecarboxylic acid, 4-(1H-indazol-4-yl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(1H-indazol-4-yl)piperazine-1-carboxylate
CAS:Formula:C16H22N4O2Molecular weight:302.3715
