
CAS 744243-43-4
:1-(2-Furanylmethyl)-2,4,5-imidazolidinetrione
Description:
1-(2-Furanylmethyl)-2,4,5-imidazolidinetrione, identified by its CAS number 744243-43-4, is a chemical compound characterized by its unique structure that includes a furan ring and an imidazolidinetrione moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, which may influence its reactivity and interactions in various chemical environments. The presence of the furan ring suggests potential for electrophilic substitution reactions, while the imidazolidinetrione structure may impart stability and specific hydrogen bonding capabilities. This compound may also display biological activity, making it of interest in pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 1-(2-Furanylmethyl)-2,4,5-imidazolidinetrione represents a versatile structure that could be explored for various applications in organic synthesis and medicinal chemistry.
Formula:C8H6N2O4
InChI:InChI=1S/C8H6N2O4/c11-6-7(12)10(8(13)9-6)4-5-2-1-3-14-5/h1-3H,4H2,(H,9,11,13)
InChI key:InChIKey=FYFXGELWLVTAAF-UHFFFAOYSA-N
SMILES:C(N1C(=O)NC(=O)C1=O)C2=CC=CO2
Synonyms:- Imidazolidinetrione, (2-furanylmethyl)-
- 1-(2-Furanylmethyl)-2,4,5-imidazolidinetrione
- 2,4,5-Imidazolidinetrione, 1-(2-furanylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.