CAS 744243-58-1

3-[3-Methoxy-4-(2-methylpropoxy)phenyl]-2-propenoic acid

Description:

3-[3-Methoxy-4-(2-methylpropoxy)phenyl]-2-propenoic acid, with the CAS number 744243-58-1, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a substituted phenyl group. The presence of a methoxy group and a branched alkoxy chain (2-methylpropoxy) contributes to its unique chemical properties, including potential hydrophobicity and reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry or materials science. Its propenoic acid functionality suggests it could participate in various chemical reactions, such as polymerization or esterification. Additionally, the presence of the aromatic ring may provide stability and influence its interaction with other molecules. As with many organic compounds, its solubility, melting point, and reactivity would depend on the specific conditions and solvents used. Overall, this compound's unique structure positions it as a potentially valuable substance in various chemical applications.

Formula: C₁₄H₁₈O₄

InChI: InChI=1S/C14H18O4/c1-10(2)9-18-12-6-4-11(5-7-14(15)16)8-13(12)17-3/h4-8,10H,9H2,1-3H3,(H,15,16)

InChI key: InChIKey=MZXJPLQWXLYEGR-UHFFFAOYSA-N

SMILES: O(C)C1=C(OCC(C)C)C=CC(C=CC(O)=O)=C1

Synonyms:

• 4-Isobutoxy-3-methoxycinnamic acid
• 3-[3-Methoxy-4-(2-methylpropoxy)phenyl]-2-propenoic acid
• 2-Propenoic acid, 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-