
CAS 744256-72-2
:Clopidogrel mesylate
Description:
Clopidogrel mesylate is a pharmaceutical compound primarily used as an antiplatelet agent to prevent blood clots in patients at risk of cardiovascular events. It is a prodrug that requires metabolic activation in the liver to exert its therapeutic effects. The substance is characterized by its ability to irreversibly inhibit the P2Y12 receptor on platelets, thereby preventing platelet aggregation. Clopidogrel mesylate is typically administered orally and is known for its relatively high bioavailability and long half-life, allowing for once-daily dosing. The mesylate salt form enhances its solubility and stability, facilitating its formulation in various dosage forms. In terms of safety, it is generally well-tolerated, although it may cause side effects such as bleeding complications and gastrointestinal disturbances. The compound is also subject to genetic variability in metabolism, which can influence its efficacy and safety profile in different individuals. Overall, Clopidogrel mesylate plays a crucial role in the management of cardiovascular diseases, particularly in patients with a history of myocardial infarction or stroke.
Formula:C16H16ClNO2S·CH4O3S
InChI:InChI=1S/C16H16ClNO2S.CH4O3S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;1H3,(H,2,3,4)/t15-;/m0./s1
InChI key:InChIKey=NYRGDYXGARXQTE-RSAXXLAASA-N
SMILES:[C@H](C(OC)=O)(N1CC2=C(CC1)SC=C2)C3=C(Cl)C=CC=C3.S(C)(=O)(=O)O
Synonyms:- Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, methanesulfonate
- Clopidogrel mesylate
- Clopidogrel methanesulfonate
- Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, methanesulfonate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-Methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate methanesulfonate
CAS:Formula:C17H20ClNO5S2Molecular weight:417.9274
