CAS 744266-99-7

N-Methyl-N-pentyl-β-alanine methyl ester

Description:

N-Methyl-N-pentyl-β-alanine methyl ester is an organic compound characterized by its structure, which includes a β-alanine backbone with a methyl and a pentyl group attached to the nitrogen atom. This compound is classified as an amino acid derivative and features both an amine and an ester functional group, contributing to its potential reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methyl ester group suggests that it may exhibit moderate polarity, making it soluble in polar solvents like water and alcohols. Its unique structure may impart specific biological activities, making it of interest in pharmaceutical and biochemical research. Additionally, the compound's CAS number, 744266-99-7, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in various fields, including medicinal chemistry and materials science. As with any chemical substance, proper handling and safety precautions should be observed.

Formula: C₁₀H₂₁NO₂

InChI: InChI=1S/C10H21NO2/c1-4-5-6-8-11(2)9-7-10(12)13-3/h4-9H2,1-3H3

InChI key: InChIKey=ZWKFEVVFVAGPDE-UHFFFAOYSA-N

SMILES: N(CCC(OC)=O)(CCCCC)C

Synonyms:

• Methyl 3-(N-Methylpentylamino)Propionate
• N-Methyl-N-pentyl-β-alanine methyl ester
• b-Alanine, N-methyl-N-pentyl-, methyl ester

N-Methyl-N-pentyl-β-alanine methyl ester

CAS: 744266-99-7

Formula: C₁₀H₂₁NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 187.2792

Ref: IN-DA00FCWY

Methyl 3-(methyl(pentyl)amino)propanoate

CAS: 744266-99-7

Methyl 3-(methyl(pentyl)amino)propanoate

Purity: 97%

Molecular weight: 187.28g/mol

Ref: 54-OR1055384

Methyl 3-(Methyl(pentyl)amino)propanoate

Controlled Product

CAS: 744266-99-7

Applications Methyl 3-(Methyl(pentyl)amino)propanoate is a useful intermediate used in the synthesis of sodium Ibandronate (I120000).
References Liu, Q., et al.: Jingxi Huagong Zhongjianti, 41, 11 (2011), Li, X., et al.: Anhui Yiyao, 16, 1074 (2012), Zhao, K., et al.: Yingyong Huagong, 40, 556 (2011)

Formula: C₁₀H₂₁NO₂

Color and Shape: Neat

Molecular weight: 187.28

Ref: TR-M334871

Ibandronate Impurity 9

CAS: 744266-99-7

Formula: C₁₀H₂₁NO₂

Molecular weight: 187.28

Ref: ST-EA-CP-I6013