
CAS 74432-69-2
:Benzoic acid, 4-(3-aminobutyl)-, methyl ester, (R)-
Description:
Benzoic acid, 4-(3-aminobutyl)-, methyl ester, (R)-, with the CAS number 74432-69-2, is an organic compound characterized by its ester functional group and an amino substituent. This compound features a benzoic acid moiety, which contributes to its aromatic properties, and a methyl ester group that enhances its solubility in organic solvents. The presence of the 3-aminobutyl chain introduces basicity and potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. The (R)- configuration indicates a specific stereochemistry, which can affect the compound's biological activity and pharmacokinetics. Typically, such compounds may exhibit properties relevant to pharmaceuticals, including potential antimicrobial or anti-inflammatory activities. Additionally, the molecular structure suggests that it may participate in various chemical reactions, such as ester hydrolysis or amine reactivity, making it of interest in synthetic organic chemistry and medicinal chemistry. Overall, this compound's unique combination of functional groups and stereochemistry positions it as a potentially valuable substance in various chemical and biological applications.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-9(13)3-4-10-5-7-11(8-6-10)12(14)15-2/h5-9H,3-4,13H2,1-2H3/t9-/m1/s1
InChI key:InChIKey=COIKKWFDURTDOU-SECBINFHSA-N
SMILES:C(OC)(=O)C1=CC=C(CC[C@@H](C)N)C=C1
Synonyms:- Benzoic acid, 4-(3-aminobutyl)-, methyl ester, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.