CAS 74436-00-3
:33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-30-propyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
Description:
The chemical substance with the name "33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-30-propyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone" and CAS number "74436-00-3" is a complex organic compound characterized by a large and intricate molecular structure. It features multiple functional groups, including hydroxyl and alkene moieties, which contribute to its reactivity and potential biological activity. The presence of numerous methyl and propyl groups suggests a hydrophobic character, which may influence its solubility and interaction with biological membranes. The compound's extensive azacyclotritriacontane framework indicates a significant degree of nitrogen incorporation, potentially affecting its stability and interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, materials science, or as surfactants, owing to their unique structural properties. However, detailed studies would be necessary to fully understand its properties, behavior, and potential applications in various fields.
Formula:C63H113N11O12
InChI:InChI=1/C63H113N11O12/c1-25-27-29-41(15)53(76)52-57(80)66-44(28-26-2)59(82)68(18)34-49(75)69(19)45(30-35(3)4)56(79)67-50(39(11)12)62(85)70(20)46(31-36(5)6)55(78)64-42(16)54(77)65-43(17)58(81)71(21)47(32-37(7)8)60(83)72(22)48(33-38(9)10)61(84)73(23)51(40(13)14)63(86)74(52)24/h25,27,35-48,50-53,76H,26,28-34H2,1-24H3,(H,64,78)(H,65,77)(H,66,80)(H,67,79)/b27-25+
Synonyms:- 74436-00-3
- 7-L-Norvaline Cyclosporin A
- Nva2-Cyclosporine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclosporin G
CAS:Formula:C63H113N11O12Color and Shape:White To Off-White SolidMolecular weight:1216.66Cyclosporin G
CAS:Controlled ProductFormula:C63H113N11O12Color and Shape:NeatMolecular weight:1216.64Cyclosporin G
CAS:Cyclosporin G is an immunosuppressive agent, which is derived from fungal sources with a specific mode of action that involves inhibiting calcineurin. The source of Cyclosporin G is primarily from the fermentation of the fungus *Tolypocladium inflatum*. Its mode of action involves binding to the cytosolic protein cyclophilin in T-lymphocytes, which subsequently inhibits the phosphatase activity of calcineurin. This inhibition prevents the dephosphorylation and nuclear translocation of the nuclear factor of activated T-cells (NFAT), thereby reducing the transcription of interleukin-2 and other cytokines critical for T-cell activation.Formula:C63H113N11O12Purity:Min. 95%Molecular weight:1,216.64 g/mol



