CAS 74443-42-8

2-(2-Nitrophenoxy)ethanamine

Description:

2-(2-Nitrophenoxy)ethanamine, with the CAS number 74443-42-8, is an organic compound characterized by the presence of both an amine and a nitro group attached to a phenoxy moiety. This compound typically appears as a solid or liquid, depending on its specific form and purity. It features a two-carbon ethyl chain linking the phenoxy group to the amine functional group, which contributes to its reactivity and potential applications in organic synthesis. The nitro group, known for its electron-withdrawing properties, can influence the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the amine group may impart basic properties, allowing for interactions with acids and other electrophiles. This compound may be of interest in pharmaceutical research, agrochemicals, or materials science due to its unique structural features. However, safety precautions should be taken when handling it, as nitro compounds can be hazardous.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c9-5-6-13-8-4-2-1-3-7(8)10(11)12/h1-4H,5-6,9H2

InChI key: InChIKey=OGGXRSWZKCEKMX-UHFFFAOYSA-N

SMILES: O(CCN)C1=C(N(=O)=O)C=CC=C1

Synonyms:

• 1-(2-Aminoethoxy)-2-nitrobenzene
• 2-Aminoethyl 2-nitrophenyl ether
• 2-Aminoethyl o-nitrophenyl ether
• Ethanamine, 2-(2-nitrophenoxy)-
• 2-(2-Nitrophenoxy)ethanamine