CAS 74444-83-0
:diethyl (2R)-2-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate
Description:
Diethyl (2R)-2-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring. The presence of two ester functional groups (from the diethyl dicarboxylate) contributes to its reactivity and solubility properties. The compound features a 4-chlorophenyl substituent, which can influence its biological activity and chemical behavior due to the electron-withdrawing nature of the chlorine atom. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its chirality, indicated by the (2R) designation, suggests that it exists as a specific enantiomer, which can have distinct properties and activities compared to its mirror image. The CAS number 74444-83-0 uniquely identifies this substance in chemical databases, facilitating its study and application in various fields of chemistry. Overall, the compound's structural features and functional groups play a significant role in determining its chemical reactivity and potential applications.
Formula:C15H17ClO4
InChI:InChI=1/C15H17ClO4/c1-3-19-13(17)15(14(18)20-4-2)9-12(15)10-5-7-11(16)8-6-10/h5-8,12H,3-4,9H2,1-2H3/t12-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
diethyl 2-(4-chlorophenyl)-1,1-cyclopropane dicarboxylate
CAS:Formula:C15H17ClO4Molecular weight:296.7461
