CAS 74447-88-4
:2,7,9-Trimethyl 4,5-dihydro-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate
Description:
2,7,9-Trimethyl 4,5-dihydro-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate, with CAS number 74447-88-4, is a complex organic compound characterized by its unique pyrroloquinoline structure, which incorporates multiple functional groups, including carboxylate moieties. This compound typically exhibits a range of chemical properties, including solubility in organic solvents, which may vary depending on the specific substituents and their positions on the molecular framework. The presence of the dioxo and tricarboxylate groups suggests potential reactivity, particularly in acid-base reactions and coordination chemistry. Additionally, the methyl groups contribute to the compound's hydrophobic character, influencing its interactions in biological systems and potential applications in pharmaceuticals or materials science. Its structural complexity may also confer interesting optical properties, making it a candidate for studies in photochemistry or as a dye. Overall, this compound's unique features make it a subject of interest in various fields of chemical research.
Formula:C17H12N2O8
InChI:InChI=1S/C17H12N2O8/c1-25-15(22)6-4-8(16(23)26-2)19-12-10(6)11-7(13(20)14(12)21)5-9(18-11)17(24)27-3/h4-5,18H,1-3H3
InChI key:InChIKey=IYEWQFSKJDXIPI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C3=C(C=C(C(OC)=O)N3)C(=O)C(=O)C2=NC(C(OC)=O)=C1
Synonyms:- 1H-Pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid, 4,5-dihydro-4,5-dioxo-, 2,7,9-trimethyl ester
- Methoxatin trimethyl ester
- Coenzyme PQQ trimethyl ester
- 1H-Pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid, 4,5-dihydro-4,5-dioxo-, trimethyl ester
- 2,7,9-Trimethyl 4,5-dihydro-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PQQ-TME
CAS:PQQ-TME inhibits α-synuclein, Aβ1-42, prion protein fibrillation more than PQQ and has 2x the BBB permeability.Formula:C17H12N2O8Color and Shape:SolidMolecular weight:372.29
