CAS 74450-59-2
:Benzoicacid, 4-amino-2-methyl-, ethyl ester
Description:
Benzoic acid, 4-amino-2-methyl-, ethyl ester, with the CAS number 74450-59-2, is an organic compound that belongs to the class of esters. It features a benzoic acid core with an amino group and a methyl substituent at specific positions on the aromatic ring. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many esters. The presence of the amino group can impart basic properties, while the ester functionality contributes to its reactivity, particularly in esterification and hydrolysis reactions. It may exhibit biological activity, making it of interest in pharmaceutical and agrochemical applications. The compound's molecular structure allows for potential interactions with biological systems, which can be explored for various applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-3-13-10(12)9-5-4-8(11)6-7(9)2/h4-6H,3,11H2,1-2H3
InChI key:RXVUWRNRNRPYMT-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C=C(C=C1)N)C
Synonyms:- 4-Amino-2-methylbenzoicacid ethyl ester
- Ethyl 4-Amino-2-Methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 4-amino-2-methylbenzoate
CAS:Formula:C10H13NO2Purity:98%Color and Shape:SolidMolecular weight:179.2157Ethyl 4-amino-2-methylbenzoate
CAS:Ethyl 4-amino-2-methylbenzoateFormula:C10H13NO2Purity:>98%Molecular weight:179.21572Ethyl 4-amino-2-methylbenzoate
CAS:Ethyl 4-amino-2-methylbenzoateFormula:C10H13NO2Purity:98%Molecular weight:179.224-Amino-2-methylbenzoic acid ethyl ester
CAS:4-Amino-2-methylbenzoic acid ethyl ester is a versatile building block that can be used in the synthesis of complex compounds. It has been shown to have a number of useful applications, such as in the synthesis of pharmaceuticals, research chemicals, and speciality chemicals. 4-Amino-2-methylbenzoic acid ethyl ester is also an important reagent for the production of high quality pharmaceuticals and intermediates. This chemical is also a useful scaffold for organic reactions.Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol




