
CAS 74465-19-3
:D-myo-Inositol 1,4-bisphosphate
Description:
D-myo-Inositol 1,4-bisphosphate (CAS 74465-19-3) is a phosphoinositide, a type of inositol phosphate that plays a crucial role in cellular signaling processes. It is characterized by its structure, which includes a myo-inositol ring with two phosphate groups attached at the 1 and 4 positions. This compound is involved in various biological functions, including the regulation of intracellular calcium levels and the modulation of protein kinase activity. D-myo-Inositol 1,4-bisphosphate is soluble in water, which facilitates its role in cellular signaling pathways. It is often studied in the context of signal transduction, particularly in relation to phosphoinositide metabolism and its effects on cellular processes such as cell growth, differentiation, and apoptosis. Additionally, it serves as a precursor for other inositol phosphates, contributing to the complexity of inositol signaling networks. Its biological significance makes it a subject of interest in research related to cell biology and pharmacology.
Formula:C6H14O12P2
InChI:InChI=1S/C6H14O12P2/c7-1-2(8)6(18-20(14,15)16)4(10)3(9)5(1)17-19(11,12)13/h1-10H,(H2,11,12,13)(H2,14,15,16)/t1-,2-,3-,4+,5+,6+/m1/s1
InChI key:InChIKey=PELZSPZCXGTUMR-RTPHHQFDSA-N
SMILES:O(P(=O)(O)O)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O
Synonyms:- D-myo-Inositol 1,4-bisphosphate
- Inositol, 1,4-bis(dihydrogen phosphate), D-myo-
- D-myo-Inositol, 1,4-bis(dihydrogen phosphate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
D-Myo-inositol 1,4-bisphosphate
CAS:D-Myo-inositol 1,4-bisphosphate is a medicinal compound that acts as an inhibitor of kinases. It has been shown to have potential therapeutic applications in cancer treatment due to its ability to inhibit tumor growth and induce apoptosis in cancer cells. D-Myo-inositol 1,4-bisphosphate is an analog of inositol phosphates found in human urine and Chinese medicinal herbs. It specifically targets protein kinases involved in the regulation of cell proliferation and survival, making it a promising candidate for anticancer therapy. Its inhibitory effects on kinase activity make it a valuable tool for studying the function of these enzymes in cellular processes.
Formula:C6H14O12P2Purity:Min. 95%Molecular weight:340.12 g/molRef: 4Z-I-2410
Discontinued product

