CAS 74467-63-3
:α-(4-Methoxyphenyl)-1-pyrrolidineacetamide
Description:
α-(4-Methoxyphenyl)-1-pyrrolidineacetamide, identified by its CAS number 74467-63-3, is a chemical compound that belongs to the class of amides. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a 4-methoxyphenyl group, enhancing its potential for various biological activities. The presence of the methoxy group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a candidate for further research in therapeutic applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H18N2O2
InChI:InChI=1S/C13H18N2O2/c1-17-11-6-4-10(5-7-11)12(13(14)16)15-8-2-3-9-15/h4-7,12H,2-3,8-9H2,1H3,(H2,14,16)
InChI key:InChIKey=QBDZSPPNNATJJA-UHFFFAOYSA-N
SMILES:C(C(N)=O)(C1=CC=C(OC)C=C1)N2CCCC2
Synonyms:- 1-Pyrrolidineacetamide, α-(4-methoxyphenyl)-
- Nsc 163362
- α-(4-Methoxyphenyl)-1-pyrrolidineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.