CAS 74470-34-1
:Methyl 1,6-dihydro-6-thioxo-3-pyridinecarboxylate
Description:
Methyl 1,6-dihydro-6-thioxo-3-pyridinecarboxylate, with the CAS number 74470-34-1, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with a thioxo group and a carboxylate ester, which contributes to its unique reactivity and properties. This compound is typically characterized by its moderate solubility in organic solvents, reflecting its polar functional groups. The presence of the thioxo group imparts potential for nucleophilic reactions, making it a candidate for various synthetic applications in organic chemistry. Additionally, the methyl ester functionality can undergo hydrolysis, leading to the formation of the corresponding carboxylic acid. Methyl 1,6-dihydro-6-thioxo-3-pyridinecarboxylate may exhibit biological activity, which could be of interest in pharmaceutical research. However, specific biological properties and safety data should be consulted from reliable sources for practical applications. Overall, this compound represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C7H7NO2S
InChI:InChI=1S/C7H7NO2S/c1-10-7(9)5-2-3-6(11)8-4-5/h2-4H,1H3,(H,8,11)
InChI key:InChIKey=MTLZNEKEIOIEAX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=CC(=S)NC1
Synonyms:- 3-Pyridinecarboxylic acid, 1,6-dihydro-6-thioxo-, methyl ester
- 6-Mercaptonicotinic acid methyl ester
- Methyl 1,6-dihydro-6-thioxo-3-pyridinecarboxylate
- Methyl 2-mercapto-5-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.