CAS 74472-34-7
:2,3,4',5-tetrachlorobiphenyl
Description:
2,3,4',5-Tetrachlorobiphenyl, with the CAS number 74472-34-7, is a member of the polychlorinated biphenyl (PCB) family, which are synthetic organic chemicals known for their environmental persistence and potential toxicity. This compound consists of two connected phenyl rings, each substituted with chlorine atoms at specific positions, which significantly influences its chemical properties. It is typically a colorless to pale yellow solid with low solubility in water but high solubility in organic solvents, making it a hydrophobic compound. Due to its chlorinated structure, it exhibits high thermal stability and resistance to degradation, contributing to its environmental persistence. 2,3,4',5-Tetrachlorobiphenyl is known for its potential to bioaccumulate in living organisms, leading to concerns regarding its effects on human health and ecosystems. It has been associated with various adverse health effects, including endocrine disruption and carcinogenicity. As a result, its production and use have been heavily regulated or banned in many countries.
Formula:C12H6Cl4
InChI:InChI=1/C12H6Cl4/c13-8-3-1-7(2-4-8)10-5-9(14)6-11(15)12(10)16/h1-6H
SMILES:c1cc(ccc1c1cc(cc(c1Cl)Cl)Cl)Cl
Synonyms:- 1,1'-Biphenyl, 2,3,4',5-Tetrachloro-
- 2,3,4',5-Pcb
- 2,3,4',5-Tetrachloro-1,1'-biphenyl
- 74472-34-7
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,3,4',5-Tetrachlorobiphenyl
CAS:Controlled Product<p>2,3,4',5-Tetrachlorobiphenyl is a chemical compound that has been shown to have anticancer properties. Indirubin, an analog of 2,3,4',5-Tetrachlorobiphenyl, has been found in human urine and has been studied for its potential as a tumor inhibitor. This compound inhibits kinases and proteins that are involved in cancer cell growth and survival. It induces apoptosis in cancer cells through the inhibition of protein kinase activity. Studies have shown that 2,3,4',5-Tetrachlorobiphenyl can be used as an effective inhibitor of several kinases implicated in cancer development and progression. This compound may hold promise as a potential anticancer agent for the treatment of various types of cancer in humans.</p>Formula:C12H6Cl4Purity:Min. 95%Molecular weight:292 g/mol
