CAS 74476-53-2

Ethyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate

Description:

Ethyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features an ethyl ester functional group, an amino group, and a para-chlorophenyl substituent, contributing to its potential biological activity. The presence of the thiazole moiety often indicates properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interaction with biological targets. The CAS number 74476-53-2 uniquely identifies this substance in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical compound.

Formula: C₁₂H₁₁ClN₂O₂S

InChI: InChI=1/C12H11ClN2O2S/c1-2-17-11(16)10-9(15-12(14)18-10)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H2,14,15)

SMILES: CCOC(=O)c1c(c2ccc(cc2)Cl)[nH]c(=N)s1

Synonyms:

• Ethyl 2-amino-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylate

Ethyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate

CAS: 74476-53-2

Formula: C₁₂H₁₁ClN₂O₂S

Molecular weight: 282.7459

Ref: IN-DA005XMH