CAS 7448-03-5
:4α-Methylzymosterol
Description:
4α-Methylzymosterol is a sterol compound that plays a significant role in the biosynthesis of sterols in various organisms, particularly in fungi and plants. It is characterized by its complex polycyclic structure, which includes a steroid backbone with specific methyl and hydroxyl functional groups. This compound is a precursor in the biosynthetic pathway leading to more complex sterols, such as cholesterol in animals and ergosterol in fungi. The presence of the methyl group at the 4α position distinguishes it from other sterols, influencing its biological activity and interactions within cellular membranes. 4α-Methylzymosterol is typically found in specific biological contexts and can be studied for its implications in cell membrane fluidity, signaling pathways, and overall cellular function. Its CAS number, 7448-03-5, is a unique identifier that facilitates its identification in chemical databases and literature. As a subject of research, it contributes to our understanding of sterol metabolism and its effects on health and disease.
Formula:C28H46O
InChI:InChI=1/C28H46O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h8,19-20,22-24,26,29H,7,9-17H2,1-6H3/t19?,20-,22?,23-,24?,26?,27?,28?/m0/s1
InChI key:InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N
SMILES:C[C@@]12C3=C([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC=C(C)C)C)(CC4)[H])[H])CC[C@]1([C@H](C)[C@@H](O)CC2)[H]
Synonyms:- (3β,4α,5α)-4-Methylcholesta-8,24-dien-3-ol
- 4α-Methyl-5α-cholesta-8(9),24-dien-3β-ol
- 4α-Methyl-5α-cholesta-8,24-dien-3β-ol
- 4α-Methyl-Δ<sup>8,24</sup>-cholestenol
- 4α-Methylzymosterol
- 5α-Cholesta-8,24-dien-3β-ol, 4α-methyl-
- 7448-03-5
- Cholesta-8,24-dien-3-ol, 4-methyl-, (3β,4α,5α)-
- (4S,5S)-4,10,13-trimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14, 15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
- (3S,4S,5S,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4α-Methylzymosterol
CAS:Controlled ProductFormula:C28H46OColor and Shape:NeatMolecular weight:398.664
