CAS 745-64-2
:PGF3α
Description:
PGF3α, or Prostaglandin F3α, is a naturally occurring compound that belongs to the class of prostaglandins, which are lipid compounds derived from fatty acids. It is characterized by its role in various physiological processes, including the regulation of inflammation, smooth muscle contraction, and modulation of blood flow. PGF3α is known for its potent biological activity, influencing reproductive functions and playing a role in the menstrual cycle. The compound is typically unstable and sensitive to light and heat, which can affect its efficacy and shelf life. In terms of structure, PGF3α contains a cyclopentane ring and multiple functional groups, including hydroxyl groups, which contribute to its reactivity and interaction with specific receptors in the body. Due to its biological significance, PGF3α is of interest in pharmacological research, particularly in the development of therapeutic agents targeting reproductive health and inflammatory conditions. However, handling and storage require careful consideration to maintain its stability and activity.
Formula:C20H32O5
InChI:InChI=1/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h3-4,6-7,12-13,15-19,21-23H,2,5,8-11,14H2,1H3,(H,24,25)/b6-3-,7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1
InChI key:InChIKey=SAKGBZWJAIABSY-SAMSIYEGSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@@H]1[C@@H](/C=C/[C@H](C/C=C\CC)O)[C@H](O)C[C@@H]1O
Synonyms:- PGF3α
- (5Z,9alpha,11alpha,13E,15S,17Z)-9,11,15-trihydroxy-Prosta-5,13,17-trien-1-oic acid
- 5-Heptenoic acid, 7-[3,5-dihydroxy-2-(3-hydroxy-1,5-octadienyl)cyclopentyl]-, stereoisomer
- Prostaglandin F3α
- Prosta-5,13,17-trien-1-oic acid, 9,11,15-trihydroxy-, (5Z,9α,11α,13E,15S,17Z)-
- (5Z,9α,11α,13E,15S,17Z)-9,11,15-Trihydroxyprosta-5,13,17-trien-1-oic acid
- (5Z,9S,11R,13E,15S,17Z)-9,11,15-Trihydroxy-5,13,17-prostatriene-1-oic acid
- (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoic acid
- (5Z,13E,15S,17Z)-9α,11α,15-Trihydroxyprosta-5,13,17-trien-1-oic acid
- PROSTAGLANDIN F3ALPHA
- 9ALPHA,11ALPHA,15S-TRIHYDROXY-PROSTA-5Z,13E,17Z-TRIEN-1-OIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.