CAS 7450-57-9
:3-Amino-4-hydroxybenzoic acid hydrazide
Description:
3-Amino-4-hydroxybenzoic acid hydrazide, with the CAS number 7450-57-9, is an organic compound characterized by its hydrazide functional group attached to a substituted benzoic acid. This compound typically exhibits properties associated with both amino acids and hydrazides, including the ability to form hydrogen bonds due to the presence of amino and hydroxyl groups. It is generally soluble in polar solvents, such as water and alcohols, owing to its hydrophilic nature. The presence of the amino group allows for potential reactivity in various chemical reactions, including acylation and condensation reactions. Additionally, the hydroxyl group contributes to its potential as a chelating agent in coordination chemistry. This compound may also exhibit biological activity, making it of interest in pharmaceutical and medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the synthesis of bioactive molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c8-5-3-4(7(12)10-9)1-2-6(5)11/h1-3,11H,8-9H2,(H,10,12)
InChI key:InChIKey=KNKNIBYXWQUDIH-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC(N)=C(O)C=C1
Synonyms:- (3-Amino-4-hydroxybenzoyl)hydrazine
- 3-Amino-4-Hydroxybenzohydrazide
- 3-Amino-4-hydroxybenzoic acid hydrazide
- Benzoic acid, 3-amino-4-hydroxy-, hydrazide
- 3-Amino-4-hydroxybenzhydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-4-hydroxybenzhydrazide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H9N3O2Purity:98%Color and Shape:Brown, PowderMolecular weight:167.173-Amino-4-hydroxybenzohydrazide
CAS:Formula:C7H9N3O2Purity:95%Color and Shape:SolidMolecular weight:167.16533-Amino-4-hydroxybenzohydrazide
CAS:3-Amino-4-hydroxybenzohydrazidePurity:95%Molecular weight:167.17g/mol3-Amino-4-hydroxybenzhydrazide
CAS:Please enquire for more information about 3-Amino-4-hydroxybenzhydrazide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C7H9N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:167.17 g/mol




