CymitQuimica logo

CAS 745043-75-8

:

ethyl 1-(4-methylphenyl)-4-oxopyrrolidine-3-carboxylate

Description:
Ethyl 1-(4-methylphenyl)-4-oxopyrrolidine-3-carboxylate is a chemical compound characterized by its unique pyrrolidine structure, which includes a carboxylate functional group and an ethyl ester moiety. This compound features a 4-methylphenyl substituent, contributing to its aromatic characteristics and potentially influencing its reactivity and solubility. The presence of the oxo group (carbonyl) at the 4-position of the pyrrolidine ring enhances its electrophilic nature, making it a candidate for various chemical reactions, including nucleophilic attacks. Ethyl 1-(4-methylphenyl)-4-oxopyrrolidine-3-carboxylate may exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in organic synthesis and drug design, where the pyrrolidine ring can serve as a scaffold for further modifications. As with many organic compounds, its physical properties, such as solubility, melting point, and stability, would depend on the specific conditions and solvents used.
Formula:C14H17NO3
InChI:InChI=1/C14H17NO3/c1-3-18-14(17)12-8-15(9-13(12)16)11-6-4-10(2)5-7-11/h4-7,12H,3,8-9H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.