CAS 745048-12-8
:1-(2-Azidoethyl)piperazine
Description:
1-(2-Azidoethyl)piperazine is a chemical compound characterized by the presence of a piperazine ring, which is a six-membered cyclic amine, and an azidoethyl group. The azido group (-N3) is known for its reactivity, particularly in click chemistry applications, making this compound valuable in synthetic organic chemistry and bioconjugation. The presence of the azido group introduces unique properties, such as the ability to undergo nucleophilic substitution reactions and participate in cycloaddition reactions, particularly with alkynes. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, which enhances its utility in various chemical reactions. Safety considerations are important when handling this compound due to the potential hazards associated with azides, including their explosive nature under certain conditions. Overall, 1-(2-Azidoethyl)piperazine serves as a versatile intermediate in the synthesis of more complex molecules in medicinal chemistry and materials science.
Formula:C6H13N5
InChI:InChI=1S/C6H13N5/c7-10-9-3-6-11-4-1-8-2-5-11/h8H,1-6H2
InChI key:InChIKey=JSOLZWXMGMAORE-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])N1CCNCC1
Synonyms:- 1-(2-Azidoethyl)piperazine
- Piperazine, 1-(2-azidoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.