CAS 745055-24-7

3-[3-[4-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]benzoic acid

Description:

3-[3-[4-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]benzoic acid, identified by its CAS number 745055-24-7, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and an oxadiazole ring. This compound features a phenyl group substituted with a 2-methoxyethoxy group, contributing to its solubility and potential biological activity. The presence of the oxadiazole ring suggests that it may exhibit interesting electronic properties and could be involved in various chemical reactions, including those related to medicinal chemistry. The carboxylic acid functional group in the benzoic acid portion may enhance its reactivity and solubility in polar solvents. Overall, this compound may have applications in pharmaceuticals or materials science, particularly in the development of new drugs or functional materials due to its unique structural features. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₈H₁₆N₂O₅

InChI: InChI=1/C18H16N2O5/c1-23-9-10-24-15-7-5-12(6-8-15)16-19-17(25-20-16)13-3-2-4-14(11-13)18(21)22/h2-8,11H,9-10H2,1H3,(H,21,22)

SMILES: COCCOc1ccc(cc1)c1nc(c2cccc(c2)C(=O)O)on1

3-(3-(4-(2-Methoxyethoxy)phenyl)-1,2,4-oxadiazol-5-yl)benzoic acid

CAS: 745055-24-7

Formula: C₁₈H₁₆N₂O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 340.3300

Ref: IN-DA003IRX