CAS 74509-79-8

5-[Ethyl(2-hydroxyethyl)amino]-2-pentanone

Description:

5-[Ethyl(2-hydroxyethyl)amino]-2-pentanone, identified by its CAS number 74509-79-8, is an organic compound characterized by its functional groups and structural features. It contains a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of an ethyl group and a hydroxyethyl amino group suggests that the compound may exhibit both hydrophilic and lipophilic properties, potentially influencing its solubility in various solvents. This compound may also participate in hydrogen bonding due to the hydroxyl group, which can affect its physical properties such as boiling point and melting point. Additionally, the amino group may impart basic characteristics, allowing for interactions with acids and other electrophiles. The structural complexity of 5-[Ethyl(2-hydroxyethyl)amino]-2-pentanone may also suggest potential biological activity, making it of interest in pharmaceutical research. Overall, its unique combination of functional groups positions it as a versatile compound in both chemical synthesis and potential therapeutic applications.

Formula: C₉H₁₉NO₂

InChI: InChI=1S/C9H19NO2/c1-3-10(7-8-11)6-4-5-9(2)12/h11H,3-8H2,1-2H3

InChI key: InChIKey=QZNLTZOIQGUVGO-UHFFFAOYSA-N

SMILES: N(CCCC(C)=O)(CCO)CC

Synonyms:

• 2-Pentanone, 5-[ethyl(2-hydroxyethyl)amino]-
• 5-(Ethyl(2-hydroxyethyl)amino)pentan-2-one
• 5-[N-Ethyl-N-(2-hydroxyethyl)amino]-2-pentanone
• 5-[Ethyl(2-hydroxyethyl)amino]-2-pentanone

Hydroxychloroquine Impurity 20

CAS: 74509-79-8

Formula: C₉H₁₉NO₂

Molecular weight: 173.26

Ref: 4Z-H-0644

Hydroxychloroquine Impurity 22

CAS: 74509-79-8

Formula: C₉H₁₉NO₂

Molecular weight: 173.26

Ref: ST-EA-CP-H4060