CAS 7451-95-8

2-Hydroxybenzeneacetaldehyde

Description:

2-Hydroxybenzeneacetaldehyde, also known as salicylaldehyde, is an organic compound with the molecular formula C8H8O2. It features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring, which contributes to its aromatic properties. This compound is typically a colorless to pale yellow liquid with a characteristic sweet, floral odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. 2-Hydroxybenzeneacetaldehyde is used in various applications, including as a precursor in the synthesis of pharmaceuticals, fragrances, and agrochemicals. Its reactivity is influenced by the presence of both the hydroxyl and aldehyde functional groups, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, it exhibits some antimicrobial properties, making it of interest in certain biological applications. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.

Formula: C₈H₈O₂

InChI: InChI=1S/C8H8O2/c9-6-5-7-3-1-2-4-8(7)10/h1-4,6,10H,5H2

InChI key: InChIKey=RFBOLEJBSGUBPZ-UHFFFAOYSA-N

SMILES: C(C=O)C1=C(O)C=CC=C1

Synonyms:

• o-Hydroxyphenylacetaldehyde
• 2-(2-Hydroxyphenyl)ethanal
• Acetaldehyde, (o-hydroxyphenyl)-
• 2-Hydroxybenzeneacetaldehyde
• Benzeneacetaldehyde, 2-hydroxy-