CAS 74513-17-0
:Octyl 4-O-β-D-galactopyranosyl-β-D-glucopyranoside
Description:
Octyl 4-O-β-D-galactopyranosyl-β-D-glucopyranoside is a glycoside compound characterized by its structure, which consists of a glucose unit linked to a galactose unit, with an octyl group attached. This compound is typically used in various applications, including as a surfactant and emulsifier in food and cosmetic formulations due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. The presence of the octyl group enhances its lipophilicity, making it effective in stabilizing emulsions. Additionally, the glycosidic bonds contribute to its stability and solubility in aqueous environments. Its biological properties may include potential prebiotic effects, promoting the growth of beneficial gut bacteria. As with many glycosides, it may exhibit low toxicity and is generally regarded as safe for use in food and personal care products. However, specific safety and regulatory assessments should be consulted for detailed information regarding its use and handling.
Formula:C20H38O11
InChI:InChI=1S/C20H38O11/c1-2-3-4-5-6-7-8-28-19-17(27)15(25)18(12(10-22)30-19)31-20-16(26)14(24)13(23)11(9-21)29-20/h11-27H,2-10H2,1H3/t11-,12-,13+,14+,15-,16-,17-,18-,19-,20+/m1/s1
InChI key:InChIKey=MASIZQYHVMQQKI-YAIANMIZSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@@H](OCCCCCCCC)[C@H](O)[C@H]1O)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O
Synonyms:- Octyl 4-O-β-D-galactopyranosyl-β-D-glucopyranoside
- Lac-grease
- β-D-Glucopyranoside, octyl 4-O-β-D-galactopyranosyl-
- Octyl β-lactoside
- Octyl lactoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Octyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
CAS:Octyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is a galactose derivative of octyl 4-O-(b-D-glucopyranosyl)-b-D-glucopyranoside. It has been used to immobilize the enzyme phospholipase A2 in an exothermic reaction. This product is a white solid that is soluble in water. Octyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside has been shown to be effective against mycobacteria such as Mycobacterium avium complex and Mycobacterium tuberculosis, but not against other bacteria. This product may be useful for the treatment of mycobacterial infections because it exhibits excisional activity and can cleave phospholipid membranes.Formula:C20H38O11Purity:Min. 95%Color and Shape:PowderMolecular weight:454.51 g/molOctyl β-D-Lactoside
CAS:Controlled ProductApplications A nonionic detergent for the solubilization of membrane bound protein.
References Zhou, B., et al.: J. Biol. Chem., 264, 12272 (1989), Pohlentz, G., et al.: Glycobiol., 4, 625 (1994),Formula:C20H38O11Color and Shape:NeatMolecular weight:454.51


