
CAS 7452-85-9
:1-(2-Hydroxy-3-methoxy-5-methylphenyl)ethanone
Description:
1-(2-Hydroxy-3-methoxy-5-methylphenyl)ethanone, also known by its CAS number 7452-85-9, is an organic compound characterized by its phenolic structure. This compound features a ketone functional group (ethanone) attached to a substituted phenol, which includes hydroxyl (-OH), methoxy (-OCH3), and methyl (-CH3) groups. The presence of these substituents contributes to its unique chemical properties, such as increased solubility in organic solvents and potential for hydrogen bonding due to the hydroxyl group. It may exhibit antioxidant properties and could be of interest in various applications, including pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential interactions with biological systems, making it a candidate for further research in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic ring, which may affect its behavior in different chemical environments. Overall, this compound represents a fascinating area of study within organic chemistry and its applications.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-6-4-8(7(2)11)10(12)9(5-6)13-3/h4-5,12H,1-3H3
InChI key:InChIKey=CGVKRFCMZCCHPI-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(O)C(OC)=CC(C)=C1
Synonyms:- 2′-Hydroxy-3′-methoxy-5′-methylacetophenone
- Ethanone, 1-(2-hydroxy-3-methoxy-5-methylphenyl)-
- 1-(2-Hydroxy-3-methoxy-5-methylphenyl)ethanone
- NSC 405807
- Acetophenone, 2′-hydroxy-3′-methoxy-5′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.