CAS 74525-43-2
:3,8,8-Trimethyl-2-oxatricyclo[4.1.1.01,3]octane
Description:
3,8,8-Trimethyl-2-oxatricyclo[4.1.1.01,3]octane, with the CAS number 74525-43-2, is a bicyclic organic compound characterized by its unique tricyclic structure that includes an oxygen atom within the ring system. This compound features three methyl groups attached to the carbon framework, which contributes to its stability and influences its physical properties. The presence of the oxygen atom in the ring structure classifies it as an oxatricyclo compound, which can affect its reactivity and interactions with other chemical species. Typically, compounds of this nature may exhibit moderate volatility and solubility in organic solvents, making them of interest in various chemical applications, including potential uses in organic synthesis or as intermediates in the production of more complex molecules. The specific arrangement of the methyl groups and the oxygen atom can also impart unique stereochemical properties, which may be relevant in fields such as medicinal chemistry or materials science. Overall, 3,8,8-Trimethyl-2-oxatricyclo[4.1.1.01,3]octane represents a fascinating example of structural diversity in organic chemistry.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-8(2)7-4-5-9(3)10(8,6-7)11-9/h7H,4-6H2,1-3H3
InChI key:InChIKey=HBHHPIRVIMLDJH-UHFFFAOYSA-N
SMILES:CC1(C)C23C(C)(O2)CCC1C3
Synonyms:- (1S,6S)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane
- 1,2-Epoxypinane
- 2,3-Epoxypinane
- 2-Oxatricyclo[4.1.1.0<sup>1,3</sup>]octane, 3,7,7-trimethyl-
- 2-Oxatricyclo[4.1.1.0<sup>1,3</sup>]octane, 3,8,8-trimethyl-
- 3,8,8-Trimethyl-2-oxatricyclo[4.1.1.0<sup>1,3</sup>]octane
- Pin-2(3)-Ene Oxide
- 3,8,8-Trimethyl-2-oxatricyclo[4.1.1.01,3]octane
- 2-Oxatricyclo[4.1.1.01,3]octane, 3,8,8-trimethyl-
- 2-Oxatricyclo[4.1.1.01,3]octane, 3,7,7-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.