CAS 74530-56-6
:1,1-Dimethylethyl 4-chloro-3-oxobutanoate
Description:
1,1-Dimethylethyl 4-chloro-3-oxobutanoate, also known by its CAS number 74530-56-6, is an organic compound characterized by its ester functional group and the presence of a chloro substituent. This compound features a butanoate backbone with a keto group at the third carbon and a chlorine atom at the fourth carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric hindrance, which can influence its reactivity and interactions with other molecules. Typically, compounds of this nature may exhibit moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. Its chemical properties may include susceptibility to nucleophilic attack at the carbonyl carbon, making it a potential intermediate in various synthetic pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts or other reagents in a reaction mixture.
Formula:C8H13ClO3
InChI:InChI=1/C8H13ClO3/c1-8(2,3)12-7(11)4-6(10)5-9/h4-5H2,1-3H3
InChI key:InChIKey=DVOUIKQENBFPRS-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C(CC(CCl)=O)=O
Synonyms:- 1,1-Dimethylethyl 4-chloro-3-oxobutanoate
- Butanoic acid, 4-chloro-3-oxo-, 1,1-dimethylethyl ester
- Tert-Butyl 4-Chloro-3-Oxobutanoate
- tert-Butyl 4-chloroacetoacetate
- tert-Butyl 4-chloro-3-oxobutyrate
- 4-Chloro-3-oxobutyric acid tert-butyl ester
- t-Butyl 4-Chloroacetoacetate
- tert.-Butyl-4-chloroacetoacetate,85%
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
tert-Butyl 4-chloro-3-oxobutanoate
CAS:tert-Butyl 4-chloro-3-oxobutanoateFormula:C8H13ClO3Purity:95%Molecular weight:192.64tert-butyl 4-chloro-3-oxobutanoate
CAS:Formula:C8H13ClO3Purity:95%Color and Shape:LiquidMolecular weight:192.6400tert-Butyl-4-chloro-3-oxobutanoate
CAS:tert-Butyl-4-chloro-3-oxobutanoateFormula:C8H13ClO3Purity:95%Molecular weight:192.64tert-Butyl-4-chloro-3-oxobutanoate
CAS:Tert-Butyl-4-chloro-3-oxobutanoate is a chiral compound that is widely used in the field of research chemicals. It is commonly employed in asymmetric synthesis methods to create various enantiomers. The chemical structure of tert-Butyl-4-chloro-3-oxobutanoate consists of a 5-carboxyphthalide heterocycle with a morpholino group and a hydroxyl group. This versatile compound has proven to be highly effective in the synthesis of dimers and monoclonal antibodies. Additionally, tert-Butyl-4-chloro-3-oxobutanoate has applications in the pharmaceutical industry, particularly in the production of famotidine and dopamine. Its nitrating properties make it an essential component for many chemical reactions. Researchers and professionals seeking high-quality chemicals for their experiments can rely on tert-Butyl-4-chloro-3-oxobutanoateFormula:C8H13ClO3Purity:Min. 95%Molecular weight:192.64 g/mol




