CAS 74533-88-3

(1R)-1,4-diphenylbutan-1-aminium

Description:

(1R)-1,4-diphenylbutan-1-aminium, with the CAS number 74533-88-3, is a quaternary ammonium compound characterized by its structure, which includes a butane backbone substituted with two phenyl groups and a positively charged ammonium group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being soluble in polar solvents and having surfactant-like behavior. Its chirality, indicated by the (1R) designation, suggests that it has specific stereochemical properties that may influence its biological activity and interactions. Quaternary ammonium compounds are often used in various applications, including as disinfectants, surfactants, and in pharmaceuticals. The presence of the diphenyl groups may enhance its hydrophobic characteristics, potentially affecting its solubility and reactivity. Overall, (1R)-1,4-diphenylbutan-1-aminium is of interest in both synthetic chemistry and potential applications in materials science and biochemistry due to its unique structural features and properties.

Formula: C₁₆H₂₀N

InChI: InChI=1/C16H19N/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12,16H,7,10,13,17H2/p+1/t16-/m1/s1