CAS 74536-79-1
:4,4'-(1-fluorohexane-3,4-diyl)diphenol
Description:
4,4'-(1-Fluorohexane-3,4-diyl)diphenol, identified by its CAS number 74536-79-1, is an organic compound characterized by the presence of two phenolic groups connected by a hexane chain that includes a fluorine substituent. This compound exhibits properties typical of diphenols, such as the ability to form hydrogen bonds due to the hydroxyl (-OH) groups, which can influence its solubility and reactivity. The fluorine atom introduces unique electronic and steric effects, potentially enhancing the compound's stability and altering its interaction with other molecules. The presence of the hexane chain contributes to its hydrophobic characteristics, which may affect its behavior in various solvents. Additionally, the compound may exhibit antioxidant properties, making it of interest in materials science and pharmaceuticals. Its synthesis and applications could be explored in fields such as polymer chemistry, where it may serve as a building block for advanced materials. However, specific safety and handling guidelines should be followed due to the potential hazards associated with chemical compounds containing fluorine.
Formula:C18H21FO2
InChI:InChI=1/C18H21FO2/c1-2-17(13-3-7-15(20)8-4-13)18(11-12-19)14-5-9-16(21)10-6-14/h3-10,17-18,20-21H,2,11-12H2,1H3
SMILES:CCC(c1ccc(cc1)O)C(CCF)c1ccc(cc1)O
Synonyms:- 1-Fluoro-3,4-bis(4-hydroxyphenyl)hexane
- Phenol, 4,4'-(1-ethyl-2-(2-fluoroethyl)-1,2-ethanediyl)bis-, (R*,S*)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.