CAS 7454-72-0
:4-Bromo-N-(4-methoxyphenyl)benzenesulfonamide
Description:
4-Bromo-N-(4-methoxyphenyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry, particularly as antibacterial agents. The presence of a bromine atom and a methoxyphenyl group contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically exhibits moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the bromine substituent, which can participate in electrophilic aromatic substitution reactions. The methoxy group enhances the electron density on the aromatic ring, potentially affecting the compound's biological activity and interaction with target molecules. Additionally, the sulfonamide moiety can engage in hydrogen bonding, which may influence its solubility in various solvents and its interaction with biological systems. Overall, 4-Bromo-N-(4-methoxyphenyl)benzenesulfonamide is of interest in research for its potential pharmacological applications and as a building block in organic synthesis.
Formula:C13H12BrNO3S
InChI:InChI=1S/C13H12BrNO3S/c1-18-12-6-4-11(5-7-12)15-19(16,17)13-8-2-10(14)3-9-13/h2-9,15H,1H3
InChI key:InChIKey=RQCJPHFHAJZWBS-UHFFFAOYSA-N
SMILES:S(NC1=CC=C(OC)C=C1)(=O)(=O)C2=CC=C(Br)C=C2
Synonyms:- Benzenesulfonamide, 4-bromo-N-(4-methoxyphenyl)-
- 4-Bromo-N-(4-methoxyphenyl)benzenesulfonamide
- Benzenesulfon-p-anisidide, 4-bromo-
- benzenesulfonamide, 4-bromo-N-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.