CAS 74543-22-9

1,6-Naphthalenedisulfonic acid, 8-amino-, sodium salt (1:1)

Description:

1,6-Naphthalenedisulfonic acid, 8-amino-, sodium salt (1:1) is an organic compound characterized by its naphthalene backbone with two sulfonic acid groups and an amino group. This compound is typically used as a dye intermediate and in various applications within the textile and paper industries due to its ability to form stable colorants. It is soluble in water, which enhances its utility in aqueous applications. The presence of sulfonic acid groups contributes to its strong acidic properties, while the amino group can participate in various chemical reactions, making it versatile in synthetic chemistry. The sodium salt form indicates that the acidic protons of the sulfonic groups have been neutralized by sodium ions, which can influence its solubility and reactivity. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, this compound is significant in industrial applications, particularly in the production of dyes and pigments.

Formula: C₁₀H₉NO₆S₂·Na

InChI: InChI=1S/C10H9NO6S2.Na/c11-8-5-7(18(12,13)14)4-6-2-1-3-9(10(6)8)19(15,16)17;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);

InChI key: InChIKey=KALUIMDTJQLCCR-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C2=C(C=C(S(=O)(=O)O)C=C2N)C=CC1.[Na]

Synonyms:

• 1,6-Naphthalenedisulfonic acid, 8-amino-, sodium salt (1:1)
• 1,6-Naphthalenedisulfonic acid, 8-amino-, monosodium salt