CAS 74556-59-5
:5-[[3-(Trifluoromethyl)phenoxy]methyl]-2-furancarboxylic acid
Description:
5-[[3-(Trifluoromethyl)phenoxy]methyl]-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and a trifluoromethyl-substituted phenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The trifluoromethyl group enhances the lipophilicity and biological activity of the molecule, making it of interest in various chemical and pharmaceutical applications. The presence of the phenoxy and furan moieties suggests potential for interactions in biological systems, possibly influencing its reactivity and solubility. Additionally, the compound may exhibit specific pharmacological properties, which can be explored in medicinal chemistry. Its CAS number, 74556-59-5, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's distinctive functional groups and structural features make it a subject of interest in research and development within the fields of organic chemistry and drug design.
Formula:C13H9F3O4
InChI:InChI=1S/C13H9F3O4/c14-13(15,16)8-2-1-3-9(6-8)19-7-10-4-5-11(20-10)12(17)18/h1-6H,7H2,(H,17,18)
InChI key:InChIKey=OJENWIFMNHMEFI-UHFFFAOYSA-N
SMILES:C(OC1=CC(C(F)(F)F)=CC=C1)C=2OC(C(O)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[[3-(trifluoromethyl)phenoxy]methyl]-
- 5-[[3-(Trifluoromethyl)phenoxy]methyl]-2-furancarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.