CAS 74556-60-8

5-[(2,4-Dichlorophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(2,4-Dichlorophenoxy)methyl]-2-furancarboxylic acid, with the CAS number 74556-60-8, is a chemical compound characterized by its unique structure that combines a furan ring with a carboxylic acid functional group and a dichlorophenoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the dichlorophenyl moiety. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting the influence of its hydrophobic aromatic components. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound may exhibit herbicidal or pesticidal properties, making it of interest in agricultural chemistry. Safety data should be consulted for handling and exposure risks, as compounds with similar structures can exhibit toxicity or environmental persistence.

Formula: C₁₂H₈Cl₂O₄

InChI: InChI=1S/C12H8Cl2O4/c13-7-1-3-10(9(14)5-7)17-6-8-2-4-11(18-8)12(15)16/h1-5H,6H2,(H,15,16)

InChI key: InChIKey=VSMPMYSNFPYXIY-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=C(Cl)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(2,4-dichlorophenoxy)methyl]-
• 5-[(2,4-Dichlorophenoxy)methyl]-2-furancarboxylic acid

5-(2,4-Dichlorophenoxymethyl)furan-2-carboxylic acid

CAS: 74556-60-8

Versatile small molecule scaffold

Formula: C₁₂H₈Cl₂O₄

Purity: Min. 95%

Molecular weight: 287.09 g/mol

Ref: 3D-ZCA55660