CAS 74556-82-4

5-[(4-Chlorophenoxy)methyl]-2-thiophenecarboxylic acid

Description:

5-[(4-Chlorophenoxy)methyl]-2-thiophenecarboxylic acid, with the CAS number 74556-82-4, is a chemical compound characterized by its unique structure that includes a thiophene ring and a chlorophenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiophene moiety, which is known for its role in various pharmacological applications. The chlorophenoxy group can enhance lipophilicity, influencing the compound's solubility and interaction with biological systems. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the chlorine atom may also impart specific reactivity and stability characteristics. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, although specific applications would depend on further research into its biological activity and efficacy.

Formula: C₁₂H₉ClO₃S

InChI: InChI=1S/C12H9ClO3S/c13-8-1-3-9(4-2-8)16-7-10-5-6-11(17-10)12(14)15/h1-6H,7H2,(H,14,15)

InChI key: InChIKey=FPNZMBIETZGMFF-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(Cl)C=C1)C=2SC(C(O)=O)=CC2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-[(4-chlorophenoxy)methyl]-
• 5-[(4-Chlorophenoxy)methyl]-2-thiophenecarboxylic acid

5-(4-Chlorophenoxymethyl)thiophene-2-carboxylic acid

CAS: 74556-82-4

Versatile small molecule scaffold

Formula: C₁₂H₉ClO₃S

Purity: Min. 95%

Molecular weight: 268.72 g/mol

Ref: 3D-ZCA55682