CAS 74568-07-3
:25,26,27,28-Tetrahydroxycalix[4]arene
Description:
25,26,27,28-Tetrahydroxycalix[4]arene is a synthetic organic compound belonging to the calixarene family, which is characterized by its cup-shaped structure formed by phenolic units linked by methylene bridges. This particular calixarene derivative features four hydroxyl groups positioned at the 25, 26, 27, and 28 positions, enhancing its solubility and reactivity. The presence of these hydroxyl groups contributes to its ability to form hydrogen bonds, making it a versatile ligand in coordination chemistry. Its unique structure allows it to selectively bind cations and anions, which is valuable in applications such as ion-selective electrodes, sensors, and drug delivery systems. Additionally, 25,26,27,28-Tetrahydroxycalix[4]arene exhibits interesting properties in supramolecular chemistry, where it can participate in host-guest interactions. The compound is typically soluble in polar solvents, and its properties can be influenced by the pH of the solution, making it a subject of interest in various fields, including materials science and biochemistry.
Formula:C28H24O4
InChI:InChI=1S/C28H24O4/c29-25-17-5-1-6-18(25)14-20-8-3-10-22(27(20)31)16-24-12-4-11-23(28(24)32)15-21-9-2-7-19(13-17)26(21)30/h1-12,29-32H,13-16H2
InChI key:InChIKey=YPNHVQZZPXPQOS-UHFFFAOYSA-N
SMILES:OC=1C=2CC=3C(O)=C(CC=4C(O)=C(CC5=C(O)C(CC1C=CC2)=CC=C5)C=CC4)C=CC3
Synonyms:- 25,26,27,28-Tetrahydroxycalix[4]aren
- 25,26,27,28-Tetrahydroxycalix[4]arene
- 74568-07-3
- Calix[4]arene-25,26,27,28-tetrol
- Calix[4]arenetetrol
- Calx 4
- Pentacyclo[19.3.1.13,7.19,13.115,19]Octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-Dodecaene-25,26,27,28-Tetrol
- Pentacyclo[19.3.1.1<sup>3,7</sup>.1<sup>9,13</sup>.1<sup>15,19</sup>]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol
- Pentacyclo[19.3.1.1<sup>3,7</sup>.1<sup>9,13</sup>.1<sup>15,19</sup>]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-5,17,25,27-tetrol
- Pentacyclo[19.3.1.1<sup>3,7</sup>.1<sup>9,13</sup>.1<sup>15,19</sup>]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-5,25,26,27-tetrol
- Pentacyclo[19.3.1.1~3,7~.1~9,13~.1~15,19~]Octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-Dodecaene-25,26,27,28-Tetrol
- Pentacyclo[19.3.1.1~3,7~.1~9,13~.1~15,19~]Octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-Dodecaene-25,26,27,28-Tetrol
- Pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Calix[4]arene (contains ca. 8% Chloroform)
CAS:Formula:C28H24O4Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:424.50Calix[4]arene, 98%
CAS:<p>Functionalized calix[4]arenes can bind DNA and induce cell transfection. Calixarenes lend themselves well to many applications because of the multiplicity of options for such structural elaboration such as in electrochemical sensors, optical sensors, chiral recognition devices, This Thermo Scientif</p>Formula:C28H24O4Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:424.50Calix[4]arene-25,26,27,28-tetrol
CAS:Calix[4]arene-25,26,27,28-tetrolPurity:98%Molecular weight:424.49g/molCalix[4]arene
CAS:Calix[4]arenes are a group of aromatic compounds that can be used as optical sensors. They are characterized by the presence of four phenyl rings and an open cavity that is accessible to solvent molecules. The calix[4]arene molecule has two free electron pairs, which makes it possible for the molecule to form stable complexes with various test samples, such as hydrochloric acid, ammonia, and nitric acid. Calix[4]arenes also have linear calibration curves that can be used to measure concentrations of test samples. When heated in the presence of oxygen and water, calix[4]arenes will emit light at a wavelength between 500-600 nm. This light emission is due to an intramolecular hydrogen bond that is formed from the nitrogen atom on one ring to the oxygen atom on another ring. Calix[4]arenes are also capable of transferring electrons from one ring to another through steric interactions. This process leads to lightFormula:C28H24O4Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:424.49 g/mol





